UDP-N-acetyl-D-glucosamine
UDP-N-acetyl-D-glucosamine, a significant molecule widely employed in the field of biomedicine, possesses multifarious applications. This pivotal entity acts as a substrate in glycosylation reactions, thereby facilitating the synthesis and alteration of glycoproteins and glycolipids. Consequently, this compound assumes an indispensable role in the management of specific ailments, including congenital disorders of glycosylation and metabolic disorders characterized by impaired glycosylation. Additionally, its utilization extends to the formulation of therapeutic interventions dedicated to rectifying glycosylation-related anomalies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 528-04-1 |
| Pricing | Inquire |
| Cas | 528-04-1 |
| Molecular Weight | 607.35 |
| Molecular Formula | C17H27N3O17P2 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)CO)O)O |