Potassium 3-thiophenetrifluoroborate
Potassium 3-thiophenetrifluoroborate is a valuable chemical compound used in the biomedical industry. It exhibits potential as a pharmaceutical intermediate with applications in the drug development of various diseases. Its unique properties make it an ideal component in the synthesis of drugs targeting specific enzyme inhibitors, antiviral agents, or anticancer therapies. With its versatile nature, Potassium 3-thiophenetrifluoroborate plays a vital role in advancing biomedical research and drug discovery efforts.
Supplier | BOC Sciences |
---|---|
Product # | 192863-37-9 |
Pricing | Inquire |
Cas | 192863-37-9 |
Molecular Weight | 190.04 |
Molecular Formula | C4H3BF3KS |
Canonical SMILES | [B-](C1=CSC=C1)(F)(F)F.[K+] |