EH44
EH44 is a carbazole derivative used as interfacial, hole transporting and contact layer in perovskite solar cell (PSC). Using EH44 can increase the performance and the lifetime of the devices. EH44 is a Li+ free, hydrophobic hole transporting material (HTM) which can eliminate degradation due to Li+ migration, supresse degradation due to moisture absorption and has long-term stability in fabricated PSC.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1879076-81-9 |
| Pricing | Inquire |
| Cas | 1879076-81-9 |
| Molecular Weight | 733.94 |
| Molecular Formula | CuSCN |
| Canonical SMILES | CCC(CCCC)CN1C2=CC(N(C3=CC=C(OC)C=C3)C4=CC=C(OC)C=C4)=CC=C2C5=CC=C(N(C6=CC=C(OC)C=C6)C7=CC=C(OC)C=C7)C=C15 |