Piperidine-4-boronic acid pinacol ester HCl
Piperidine-4-boronic acid pinacol ester HCl is a compound of utmost importance in the biomedical sector and demonstrates remarkable effectiveness in the management of an assortment of ailments encompassing cancer, diabetes, and neurological disorders. Distinguished by its exceptional attributes, it facilitates the delivery of drugs to specific sites, resulting in improved therapeutic effects. Thus, this product serves as a propitious instrument for scholars, catalyzing the exploration of groundbreaking remedies for diverse medical afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1218790-99-8 |
| Pricing | Inquire |
| Cas | 1218790-99-8 |
| Molecular Weight | 247.6 |
| Molecular Formula | C11H22BNO2.ClH |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCNCC2.Cl |