Beclomethasone Dipropionate Monohydrate
Beclomethasone Dipropionate Monohydrate is a corticosteroid used in the biomedical industry to study various respiratory conditions, such as asthma and chronic obstructive pulmonary disease (COPD). It possesses anti-inflammatory and immunosuppressive properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 77011-63-3 |
| Pricing | Inquire |
| Cas | 77011-63-3 |
| Molecular Weight | 539.08 |
| Molecular Formula | C28H39ClO8 |
| Canonical SMILES | CCC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)Cl)O)C)C)OC(=O)CC.O |