HEXAFLUOROGLUTARIC ANHYDRIDE
Hexafluoroglutaric anhydride is an indispensable chemical compound pervasively applied in the biomedical sector and holds immense promise for driving groundbreaking innovation in pharmaceutical concoctions and research-oriented substances. Its multifaceted mechanism profoundly impedes distinct enzymatic processes, thereby paving the way for combating a myriad of ailments such as cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 376-68-1 |
| Pricing | Inquire |
| Cas | 376-68-1 |
| Molecular Weight | 222.04 |
| Molecular Formula | C5F6O3 |
| Canonical SMILES | C1(=O)C(C(C(C(=O)O1)(F)F)(F)F)(F)F |