CHPG
CHPG is a selective metabotropic glutamate 5 (mGlu5) receptor agonist, and it is inactive in CHO cells. CHPG potentiates NMDA-induced depolarizations in rat hippocampal slices, and promotes proliferation of human embryonic cortical NSCs with activation of the MAPKs signaling pathway.
| Supplier | BOC Sciences |
|---|---|
| Product # | 170846-74-9 |
| Pricing | Inquire |
| Cas | 170846-74-9 |
| Molecular Weight | 201.61 |
| Molecular Formula | C8H8NO3Cl |
| Canonical SMILES | C1=CC(=C(C=C1O)C(C(=O)O)N)Cl |