Dichloro[2-(4,5-dihydro-2-oxazolyl)quinoline]palladium(II)
Dichloro[2-(4,5-dihydro-2-oxazolyl)quinoline]palladium(II) is an invaluable compound widely employed in the field of biomedicine. This compound displays remarkable potential in the advancement of anti-neoplastic agents owing to its proficient ability to selectively target malignant cells. Notably, this intricate compound has exhibited promising outcomes in the drug development of an array of malignancies, encompassing breast, lung, and prostate cancer. Its mode of action precisely involves the binding to specified cellular receptors, thereby impeding tumor growth and hampering uncontrolled proliferative activity. Additionally, the distinctive structural attributes of this compound render it an optimal candidate warranting extensive exploration in the realm of cancer therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1150097-98-5 |
| Pricing | Inquire |
| Cas | 1150097-98-5 |
| Molecular Weight | 375.55 |
| Molecular Formula | C12H10Cl2N2OPd |
| Canonical SMILES | C1COC(=N1)C2=NC3=CC=CC=C3C=C2.Cl[Pd]Cl |