2-Hydroxybenzylbeta-D-glucopyranoside
2-Hydroxybenzylbeta-D-glucopyranoside: a naturally occurring compound found in plants which displays potent anti-inflammatory and antioxidant properties, has been shown to effectively manage diabetes and cardiovascular diseases. By effectively increasing insulin sensitivity and reducing blood glucose levels, it is a promising therapeutic agent for the management of diabetes. Furthermore, it can prevent the development of atherosclerosis and decrease the risk of heart attacks and strokes - making it a powerful tool in the fight against these conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7724-09-6 |
| Pricing | Inquire |
| Cas | 7724-09-6 |
| Molecular Weight | 286.28 |
| Molecular Formula | C13H18O7 |
| Canonical SMILES | C1=CC=C(C(=C1)COC2C(C(C(C(O2)CO)O)O)O)O |