(2R,3S,4R,5S)-3,4-O-Isopropylidene-2-methyl-3,4,5-piperidinetriol
(2R,3S,4R,5S)-3,4-O-Isopropylidene-2-methyl-3,4,5-piperidinetriol, an essential component in the biomedical sector, holds immense importance for drug discovery. Its significance lies in the formulation of targeted medications addressing a broad range of medical ailments including cancer, neurodegenerative disorders, and cardiovascular conditions. This compound's distinct molecular arrangement and inherent characteristics render it an ideal candidate for the creation of efficacious therapeutic interventions. Its versatile nature paves the way for groundbreaking advancements in the realm of medicine, facilitating novel approaches to combat complex diseases plaguing mankind.
| Supplier | BOC Sciences |
|---|---|
| Product # | 324759-96-8 |
| Pricing | Inquire |
| Cas | 324759-96-8 |
| Molecular Weight | 187.24 |
| Molecular Formula | C9H17NO3 |
| Canonical SMILES | CC1C2C(C(CN1)O)OC(O2)(C)C |