Cephradine
It is produced by the strain of Semisynthetic first generation cephalosporin. It has the commonness of the first generation cephalosporin and its antibacterial action is similar to that of cefalexin. It is characterized by that it can be injected or given orally.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00762 |
| Pricing | Inquire |
| Cas | 38821-53-3 |
| Molecular Weight | 349.41 |
| Molecular Formula | C16H19N3O4S |
| Canonical SMILES | CC1=C(N2C(C(C2=O)NC(=O)C(C3=CCC=CC3)N)SC1)C(=O)O |