1-[4-[2-Dimethylamino)ethoxy]phenyl]-2-phenyl-1-butanone Hydrochloride
Hydrochloride salt of 1-[4-[2-Dimethylamino)ethoxy]phenyl]-2-phenyl-1-butanone is a mild skin irritant and is also used as a reagent in the preparation of Tamoxifen, a selective estrogen response modifier (SERM), protein kinase C inhibitor and anti-angiogenetic factor.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB067298 |
| Pricing | Inquire |
| Cas | 94911-67-8 |
| Molecular Weight | 347.88 |
| Molecular Formula | C20H26ClNO2 |
| Canonical SMILES | CCC(C1=CC=CC=C1)C(=O)C2=CC=C(C=C2)OCCN(C)C.Cl |