ZK-Thiazolidinone
ZK-Thiazolidinone, also known as TAL, is an ATP-competitive inhibitor of PLK1. In vitro, ZK-Thiazolidinone counteracts the role of Plk1 in previously established functions, notably, sister chromatid separation, centrosome maturation, and bipolar spindle assembly.
| Supplier | BOC Sciences |
|---|---|
| Product # | 891849-87-9 |
| Pricing | Inquire |
| Cas | 891849-87-9 |
| Molecular Weight | 497.58 |
| Molecular Formula | C23H30F3N5O2S |
| Canonical SMILES | CCN1C(SC(C1=O)CNC2=CC=CC(=C2)CCN3CCCC3)C(C#N)C(=O)NCC(F)(F)F |