BX 430
BX 430 is a selective P2X4 allosteric antagonist (IC50 = 0.54 μM) binding noncompetitively to extracellular allosteric site. It exhibits >10-fold selectivity for human P2X4 receptors over P2X1, P2X2, P2X3, P2X5 and P2X7 receptors. BX 430 is inactive at mouse and rat P2X4 receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 688309-70-8 |
| Pricing | Inquire |
| Cas | 688309-70-8 |
| Molecular Weight | 413.11 |
| Molecular Formula | C15H15Br2N3O |
| Canonical SMILES | CC(C)C1=CC(=C(C(=C1)Br)NC(=O)NC2=CN=CC=C2)Br |