Coumarin 500
Coumarin 500 is a prodigious and exceedingly efficacious compound frequently employed in the realm of biomedicine. This compound is known for its potential efficacy against various diseases, such as malignancies and cardiovascular diseases, and is endowed with unique chemical properties. The benefits of Coumarin 500 have an impact on pharmaceutical advancements and complex scientific inquiry, making it an indispensable tool for insightful biomedical practitioners.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52840-38-7 |
| Pricing | Inquire |
| Cas | 52840-38-7 |
| Molecular Weight | 257.21 |
| Molecular Formula | C12H10F3NO2 |
| Canonical SMILES | CCNC1=CC2=C(C=C1)C(=CC(=O)O2)C(F)(F)F |