Calindol hydrochloride
The calcium sensing receptor (CaSR) has a long amino terminal tail typical of family 3 of GPCRs including the metabotropic glutamate receptors, the c-aminobutyric acid B receptor and certain pheromone and taste receptors. Calindol hydrochloride is a new calcimimetic compound acting as (CaSR). It is a positive allosteric modulator of the human Ca2+ receptor which activates an extracellular ligand-binding domain-deleted, Rhodopsin-like, seven-transmembrane structure in the absence of Ca2+. Calindol is used to study the properties and distribution of CaSR in different types of cells and tissues.
| Supplier | BOC Sciences |
|---|---|
| Product # | 729610-18-8 |
| Pricing | Inquire |
| Cas | 729610-18-8 |
| Molecular Weight | 336.9 |
| Molecular Formula | C21H20N2·HCl |
| Canonical SMILES | C[C@H](C1=C(C=CC=C2)C2=CC=C1)NCC3=CC4=CC=CC=C4N3.Cl |