3-Indolyl b-D-glucuronide sodium salt
3-Indolyl b-D-glucuronide sodium salt is a sodium salt form of 3-Indolyl b-D-glucuronide, a chemical compound widely used in the biomedical industry for research purposes. It is utilized as a substrate in enzymatic assays to study glucuronidation reactions and drug metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 119736-51-5 |
| Pricing | Inquire |
| Cas | 119736-51-5 |
| Molecular Weight | 331.25 |
| Molecular Formula | C14H14NNaO7 |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)OC3C(C(C(C(O3)C(=O)[O-])O)O)O.[Na+] |