Reverse Abasic Phosphoramidite
Reverse Abasic Phosphoramidite is a specialized compound used in oligonucleotide synthesis. It allows for the controlled introduction of abasic sites, which are sites lacking a nucleobase, into oligonucleotide sequences. These abasic sites serve as versatile molecular tools for various applications in molecular biology, including studying nucleic acid structure, elucidating enzyme kinetics, and investigating nucleic acid-protein interactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00740 |
| Pricing | Inquire |
| Cas | 401813-16-9 |
| Molecular Weight | 620.73 |
| Molecular Formula | C35H45N2O6P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC1C(CCO1)OC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC |