1,5,6-Trihydroxy-3-methoxyxanthone
1,5,6-Trihydroxy-3-methoxyxanthone is isolated from adventitious roots of St. John's wort (Hypericum perforatum L.). It exhibits antioxidant activity in the intracellular reactive oxygen species (ROS) radical scavenging 2',7'-dichlorfluorescein-diacetate (DCFDA) assay and cytotoxicity against HL-60 human promyelocytic leukemia cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7299 |
| Pricing | Inquire |
| Cas | 50868-52-5 |
| Molecular Weight | 274.228 |
| Molecular Formula | C14H10O6 |
| Canonical SMILES | COC1=CC(=C2C(=C1)OC3=C(C2=O)C=CC(=C3O)O)O |