Telavancin hydrochloride
Telavancin hydrochloride, a derivative of vancomycin, is a potent medication used to combat an array of bacterial infections. These infections include, but are not limited to, skin and soft tissue infections, bloodstream infections caused by Staphylococcus aureus, and Streptococcus pyogenes. Its mode of action is to repress the synthesis of bacterial cell walls. Its efficacy against methicillin-resistant organisms makes it a highly effective option against bacterial infections in clinical settings.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0046-464010 |
| Pricing | Inquire |
| Cas | 560130-42-9 |
| Molecular Weight | 1792.096 |
| Molecular Formula | C80H106Cl2N11O27P·HCl |
| Canonical SMILES | CCCCCCCCCCNCCNC1(CC(OC(C1O)C)OC2C(C(C(OC2OC3=C4C=C5C=C3OC6=C(C=C(C=C6)C(C(C(=O)NC(C(=O)NC5C(=O)NC7C8=CC(=C(C=C8)O)C9=C(C(=C(C=C9C(NC(=O)C(C(C1=CC(=C(O4)C=C1)Cl)O)NC7=O)C(=O)O)O)CNCP(=O)(O)O)O)CC(=O)N)NC(=O)C(CC(C)C)NC)O)Cl)CO)O)O)C.Cl |