4-Chloro-7,8-dimethoxyquinoline
4-Chloro-7,8-dimethoxyquinoline is a highly potent compound extensively utilized in the research of ailments encompassing fungal infections, malaria and cancer. This arises from its unparalleled chemical architecture, which actively obstructs distinct enzymatic processes and pathways intricately linked to these afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99878-79-2 |
| Pricing | Inquire |
| Cas | 99878-79-2 |
| Molecular Weight | 223.66 |
| Molecular Formula | C11H10ClNO2 |
| Canonical SMILES | COC1=C(C2=NC=CC(=C2C=C1)Cl)OC |