9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-(naphthalen-1-yl)purine
9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-(naphthalen-1-yl)purine is an exquisite antiviral compound harnessed for studying the treacherous menace of viral infections. Renowned for its ability to perturb viral nucleic acid enhancement and impede viral polymerases, this exceptional compound undeniably stifles viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1612191-92-0 |
| Pricing | Inquire |
| Cas | 1612191-92-0 |
| Molecular Weight | 380.37 |
| Molecular Formula | C20H17FN4O3 |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2C3=C4C(=NC=N3)N(C=N4)C5C(C(C(O5)CO)F)O |