4-(4-Aminophenyl)benzonitrile
4-(4-Aminophenyl)benzonitrile (CAS# 4854-84-6) is used as a reagent in the synthesis of pirinixic acid derivatives which serve as dual microsomal PGE2 synthase-1/5-lipoxygenase inhibitors. Also used as a reagent in the synthesis of novel diazepane derivatives as factor Xa inhibitors with potent anticoagulant and antithrombotic activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4854-84-6 |
| Pricing | Inquire |
| Cas | 4854-84-6 |
| Molecular Weight | 194.23 |
| Molecular Formula | C13H10N2 |
| Canonical SMILES | C1=CC(=CC=C1C#N)C2=CC=C(C=C2)N |