CCG 203971
CCG 203971 is an inhibitor of SRE activation in the prostate cancer cell line PC-3 (IC50 = 6.4 μM). CCG 203971 inhibits fibrosis by targeting the MRTF/SRF gene transcription pathway, and inhibits proliferation of SSc-derived dermal fibroblasts. It also suppresses PC-3 cell migration in scratch wound assays (IC50 = 4.2 μM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1443437-74-8 |
| Pricing | Inquire |
| Cas | 1443437-74-8 |
| Molecular Weight | 408.88 |
| Molecular Formula | C23H21ClN2O3 |
| Canonical SMILES | C1CC(CN(C1)C(=O)C2=CC=CC(=C2)C3=CC=CO3)C(=O)NC4=CC=C(C=C4)Cl |