Indoleglycerol
Indoleglycerol is an intermediate in the synthesis of Indole-3-glycerol Phosphate Disodium Salt (I627088), which is transformed into indole in some plants via the enzyme indole-3-glycerol phosphate lyase in order to defend against herbivore insects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB063651 |
| Pricing | Inquire |
| Cas | 13615-41-3 |
| Molecular Weight | 207.23 |
| Molecular Formula | C11H13NO3 |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)C(C(CO)O)O |