4,6-Dibenzoylresorcinol
4,6-Dibenzoylresorcinol, a chemical compound ubiquitous in the biomedical sector, serves as a fundamental skin-lightening agent and its efficacy against hyperpigmentation disorders, including melasma, has been established. By inhibiting melanin production, 4,6-dibenzoylresorcinol considerably reduces skin pigmentation, resulting in white-toned skin. It also features potent antioxidant and antibacterial properties which grant it further potential to combat various dermatological conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-106535 |
| Pricing | Inquire |
| Cas | 3088-15-1 |
| Molecular Weight | 318.32 |
| Molecular Formula | C20H14O4 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2O)O)C(=O)C3=CC=CC=C3 |