Volasertib
BI 6727 (Volasertib) is a small highly potent Polo-like kinase inhibitor (Plk) with an IC50 of 0 .87 nM and EC50 of 11-37 nM on a panel of cancer cell lines, which exhibited significant anti-proliferative in multiple cancer models, including a model of taxane-resistant colorectal cancer. BI 6727 (Volasertib) caused programmed cell death in colon and non-small cell lung cancer cells both in vitro and in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | 755038-65-4 |
| Pricing | Inquire |
| Cas | 755038-65-4 |
| Molecular Weight | 618.827 |
| Molecular Formula | C34H50N8O3 |
| Canonical SMILES | CCC1C(=O)N(C2=CN=C(N=C2N1C(C)C)NC3=C(C=C(C=C3)C(=O)NC4CCC(CC4)N5CCN(CC5)CC6CC6)OC)C |